C24H36F2O3 — CID 143889272
2-butyl-5-[[4-[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-yl]oxymethyl]oxane (PubChem CID 143889272) has the molecular formula C24H36F2O3 and a molecular weight of 410.55 g/mol. Its IUPAC name is 2-butyl-5-[[4-[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-yl]oxymethyl]oxane.
| Compound Name | 2-butyl-5-[[4-[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-yl]oxymethyl]oxane |
|---|---|
| PubChem CID | 143889272 |
| Molecular Formula | C24H36F2O3 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 2-butyl-5-[[4-[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-yl]oxymethyl]oxane |
| SMILES | CCCCC1CCC(COC2=CC=C(/C(CC)=C(F)/C(F)=C(\C)OC)CC2)CO1 |
| InChI | InChI=1S/C24H36F2O3/c1-5-7-8-20-12-9-18(15-28-20)16-29-21-13-10-19(11-14-21)22(6-2)24(26)23(25)17(3)27-4/h10,13,18,20H,5-9,11-12,14-16H2,1-4H3/b23-17-,24-22- |
| InChIKey | HDJCEVLHGRMAFM-GQAHOOSCSA-N |
| XLogP | 7.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|