C17H28O — CID 143890955
ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene (PubChem CID 143890955) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene.
| Compound Name | ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene |
|---|---|
| PubChem CID | 143890955 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene |
| SMILES | CC.COc1ccc(C2CCC(C)C2(C)C)cc1 |
| InChI | InChI=1S/C15H22O.C2H6/c1-11-5-10-14(15(11,2)3)12-6-8-13(16-4)9-7-12;1-2/h6-9,11,14H,5,10H2,1-4H3;1-2H3 |
| InChIKey | UYKWPWJARSMBAU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |