About ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene
ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene (PubChem CID 143890955) has the molecular formula C17H28O
and a molecular weight of 248.41 g/mol. Its IUPAC name is ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene.
Molecular Properties
| Compound Name | ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene |
| PubChem CID | 143890955 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene |
| SMILES | CC.COc1ccc(C2CCC(C)C2(C)C)cc1 |
| InChI | InChI=1S/C15H22O.C2H6/c1-11-5-10-14(15(11,2)3)12-6-8-13(16-4)9-7-12;1-2/h6-9,11,14H,5,10H2,1-4H3;1-2H3 |
| InChIKey | UYKWPWJARSMBAU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene?
The IUPAC name of ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene (CID 143890955) is ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene.
What is the SMILES notation for ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene?
The canonical SMILES for ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene is CC.COc1ccc(C2CCC(C)C2(C)C)cc1.
What is the InChIKey of ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene?
The InChIKey is UYKWPWJARSMBAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O.C2H6/c1-11-5-10-14(15(11,2)3)12-6-8-13(16-4)9-7-12;1-2/h6-9,11,14H,5,10H2,1-4H3;1-2H3.
What are the key properties of ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene?
ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene has a molecular weight of 248.41 g/mol, XLogP of 5.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxy-4-(2,2,3-trimethylcyclopentyl)benzene is sourced from PubChem (CID 143890955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).