C8H16OS — CID 143890970
2,2-dimethyl-3-methylsulfanylcyclopentan-1-ol (PubChem CID 143890970) has the molecular formula C8H16OS and a molecular weight of 160.28 g/mol. Its IUPAC name is 2,2-dimethyl-3-methylsulfanylcyclopentan-1-ol.
| Compound Name | 2,2-dimethyl-3-methylsulfanylcyclopentan-1-ol |
|---|---|
| PubChem CID | 143890970 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 2,2-dimethyl-3-methylsulfanylcyclopentan-1-ol |
| SMILES | CSC1CCC(O)C1(C)C |
| InChI | InChI=1S/C8H16OS/c1-8(2)6(9)4-5-7(8)10-3/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | PFEOTVDUDVZGGS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |