C15H24S — CID 143892414
acetylene;(8S)-2,8-dimethyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene;ethane (PubChem CID 143892414) has the molecular formula C15H24S and a molecular weight of 236.42 g/mol. Its IUPAC name is acetylene;(8S)-2,8-dimethyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene;ethane.
| Compound Name | acetylene;(8S)-2,8-dimethyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene;ethane |
|---|---|
| PubChem CID | 143892414 |
| Molecular Formula | C15H24S |
| Molecular Weight | 236.42 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | acetylene;(8S)-2,8-dimethyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene;ethane |
| SMILES | C#C.CC.Cc1cc2c(s1)[C@@H](C)CCCC2 |
| InChI | InChI=1S/C11H16S.C2H6.C2H2/c1-8-5-3-4-6-10-7-9(2)12-11(8)10;2*1-2/h7-8H,3-6H2,1-2H3;1-2H3;1-2H/t8-;;/m0../s1 |
| InChIKey | BZOYFGHPOJPMRX-JZGIKJSDSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|