C31H37N3O2 — CID 143894056
[3-methylidene-2-[2-[(1-phenylpyrazol-4-yl)methylamino]ethyl]cyclobutyl] 1-phenylcycloheptane-1-carboxylate (PubChem CID 143894056) has the molecular formula C31H37N3O2 and a molecular weight of 483.66 g/mol. Its IUPAC name is [3-methylidene-2-[2-[(1-phenylpyrazol-4-yl)methylamino]ethyl]cyclobutyl] 1-phenylcycloheptane-1-carboxylate.
| Compound Name | [3-methylidene-2-[2-[(1-phenylpyrazol-4-yl)methylamino]ethyl]cyclobutyl] 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 143894056 |
| Molecular Formula | C31H37N3O2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | [3-methylidene-2-[2-[(1-phenylpyrazol-4-yl)methylamino]ethyl]cyclobutyl] 1-phenylcycloheptane-1-carboxylate |
| SMILES | C=C1CC(OC(=O)C2(c3ccccc3)CCCCCC2)C1CCNCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C31H37N3O2/c1-24-20-29(36-30(35)31(17-10-2-3-11-18-31)26-12-6-4-7-13-26)28(24)16-19-32-21-25-22-33-34(23-25)27-14-8-5-9-15-27/h4-9,12-15,22-23,28-29,32H,1-3,10-11,16-21H2 |
| InChIKey | RSYUMSOQIKUOIH-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|