C31H37N3O3 — CID 89131084
[(1S)-3-ethenyl-2-[2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]cyclobutyl] 1-phenylcycloheptane-1-carboxylate (PubChem CID 89131084) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is [(1S)-3-ethenyl-2-[2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]cyclobutyl] 1-phenylcycloheptane-1-carboxylate.
| Compound Name | [(1S)-3-ethenyl-2-[2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]cyclobutyl] 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 89131084 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | [(1S)-3-ethenyl-2-[2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]cyclobutyl] 1-phenylcycloheptane-1-carboxylate |
| SMILES | C=CC1C[C@H](OC(=O)C2(c3ccccc3)CCCCCC2)C1CCNCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C31H37N3O3/c1-2-23-21-27(36-30(35)31(18-11-3-4-12-19-31)25-15-9-6-10-16-25)26(23)17-20-32-22-28-33-29(34-37-28)24-13-7-5-8-14-24/h2,5-10,13-16,23,26-27,32H,1,3-4,11-12,17-22H2/t23?,26?,27-/m0/s1 |
| InChIKey | IWNOBEUBZYUBRG-YTZIBCIGSA-N |
| XLogP | 6.24 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|