C34H41NO2 — CID 88997988
[(1S)-3-ethenyl-2-[2-(2-naphthalen-2-ylethylamino)ethyl]cyclobutyl] 1-phenylcycloheptane-1-carboxylate (PubChem CID 88997988) has the molecular formula C34H41NO2 and a molecular weight of 495.71 g/mol. Its IUPAC name is [(1S)-3-ethenyl-2-[2-(2-naphthalen-2-ylethylamino)ethyl]cyclobutyl] 1-phenylcycloheptane-1-carboxylate.
| Compound Name | [(1S)-3-ethenyl-2-[2-(2-naphthalen-2-ylethylamino)ethyl]cyclobutyl] 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 88997988 |
| Molecular Formula | C34H41NO2 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | [(1S)-3-ethenyl-2-[2-(2-naphthalen-2-ylethylamino)ethyl]cyclobutyl] 1-phenylcycloheptane-1-carboxylate |
| SMILES | C=CC1C[C@H](OC(=O)C2(c3ccccc3)CCCCCC2)C1CCNCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H41NO2/c1-2-27-25-32(37-33(36)34(20-10-3-4-11-21-34)30-14-6-5-7-15-30)31(27)19-23-35-22-18-26-16-17-28-12-8-9-13-29(28)24-26/h2,5-9,12-17,24,27,31-32,35H,1,3-4,10-11,18-23,25H2/t27?,31?,32-/m0/s1 |
| InChIKey | ISFASONDLUDROD-SPSRHUBNSA-N |
| XLogP | 7.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|