C26H32N4O3 — CID 88997962
[(1S)-3-ethenyl-2-[2-[[2-oxo-2-(pyrazin-2-ylamino)ethyl]amino]ethyl]cyclobutyl] 1-phenylcyclopentane-1-carboxylate (PubChem CID 88997962) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is [(1S)-3-ethenyl-2-[2-[[2-oxo-2-(pyrazin-2-ylamino)ethyl]amino]ethyl]cyclobutyl] 1-phenylcyclopentane-1-carboxylate.
| Compound Name | [(1S)-3-ethenyl-2-[2-[[2-oxo-2-(pyrazin-2-ylamino)ethyl]amino]ethyl]cyclobutyl] 1-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 88997962 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | [(1S)-3-ethenyl-2-[2-[[2-oxo-2-(pyrazin-2-ylamino)ethyl]amino]ethyl]cyclobutyl] 1-phenylcyclopentane-1-carboxylate |
| SMILES | C=CC1C[C@H](OC(=O)C2(c3ccccc3)CCCC2)C1CCNCC(=O)Nc1cnccn1 |
| InChI | InChI=1S/C26H32N4O3/c1-2-19-16-22(21(19)10-13-27-18-24(31)30-23-17-28-14-15-29-23)33-25(32)26(11-6-7-12-26)20-8-4-3-5-9-20/h2-5,8-9,14-15,17,19,21-22,27H,1,6-7,10-13,16,18H2,(H,29,30,31)/t19?,21?,22-/m0/s1 |
| InChIKey | QPJJPIHALPSMEF-VTLFHKLASA-N |
| XLogP | 3.64 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|