C26H32N4O3S — CID 143893411
[3-ethynyl-2-[2-[[2-oxo-2-(pyridazin-3-ylamino)ethyl]amino]ethyl]cyclobutyl] 1-thiophen-2-ylcycloheptane-1-carboxylate (PubChem CID 143893411) has the molecular formula C26H32N4O3S and a molecular weight of 480.63 g/mol. Its IUPAC name is [3-ethynyl-2-[2-[[2-oxo-2-(pyridazin-3-ylamino)ethyl]amino]ethyl]cyclobutyl] 1-thiophen-2-ylcycloheptane-1-carboxylate.
| Compound Name | [3-ethynyl-2-[2-[[2-oxo-2-(pyridazin-3-ylamino)ethyl]amino]ethyl]cyclobutyl] 1-thiophen-2-ylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 143893411 |
| Molecular Formula | C26H32N4O3S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | [3-ethynyl-2-[2-[[2-oxo-2-(pyridazin-3-ylamino)ethyl]amino]ethyl]cyclobutyl] 1-thiophen-2-ylcycloheptane-1-carboxylate |
| SMILES | C#CC1CC(OC(=O)C2(c3cccs3)CCCCCC2)C1CCNCC(=O)Nc1cccnn1 |
| InChI | InChI=1S/C26H32N4O3S/c1-2-19-17-21(20(19)11-15-27-18-24(31)29-23-10-7-14-28-30-23)33-25(32)26(22-9-8-16-34-22)12-5-3-4-6-13-26/h1,7-10,14,16,19-21,27H,3-6,11-13,15,17-18H2,(H,29,30,31) |
| InChIKey | COLLOGKIKKBNOL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|