C30H34N2O3S — CID 143894030
[3-ethynyl-2-[2-[(3-phenyl-1,2-oxazol-5-yl)methylamino]ethyl]cyclobutyl] 1-thiophen-2-ylcycloheptane-1-carboxylate (PubChem CID 143894030) has the molecular formula C30H34N2O3S and a molecular weight of 502.68 g/mol. Its IUPAC name is [3-ethynyl-2-[2-[(3-phenyl-1,2-oxazol-5-yl)methylamino]ethyl]cyclobutyl] 1-thiophen-2-ylcycloheptane-1-carboxylate.
| Compound Name | [3-ethynyl-2-[2-[(3-phenyl-1,2-oxazol-5-yl)methylamino]ethyl]cyclobutyl] 1-thiophen-2-ylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 143894030 |
| Molecular Formula | C30H34N2O3S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | [3-ethynyl-2-[2-[(3-phenyl-1,2-oxazol-5-yl)methylamino]ethyl]cyclobutyl] 1-thiophen-2-ylcycloheptane-1-carboxylate |
| SMILES | C#CC1CC(OC(=O)C2(c3cccs3)CCCCCC2)C1CCNCc1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C30H34N2O3S/c1-2-22-19-27(34-29(33)30(28-13-10-18-36-28)15-8-3-4-9-16-30)25(22)14-17-31-21-24-20-26(32-35-24)23-11-6-5-7-12-23/h1,5-7,10-13,18,20,22,25,27,31H,3-4,8-9,14-17,19,21H2 |
| InChIKey | FXNMEMOUQBANDB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|