C19H27NO2S — CID 148803133
[(7S)-3-azabicyclo[4.2.0]octan-7-yl] 1-thiophen-2-ylcycloheptane-1-carboxylate (PubChem CID 148803133) has the molecular formula C19H27NO2S and a molecular weight of 333.50 g/mol. Its IUPAC name is [(7S)-3-azabicyclo[4.2.0]octan-7-yl] 1-thiophen-2-ylcycloheptane-1-carboxylate.
| Compound Name | [(7S)-3-azabicyclo[4.2.0]octan-7-yl] 1-thiophen-2-ylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 148803133 |
| Molecular Formula | C19H27NO2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | [(7S)-3-azabicyclo[4.2.0]octan-7-yl] 1-thiophen-2-ylcycloheptane-1-carboxylate |
| SMILES | O=C(O[C@H]1CC2CNCCC21)C1(c2cccs2)CCCCCC1 |
| InChI | InChI=1S/C19H27NO2S/c21-18(22-16-12-14-13-20-10-7-15(14)16)19(17-6-5-11-23-17)8-3-1-2-4-9-19/h5-6,11,14-16,20H,1-4,7-10,12-13H2/t14?,15?,16-/m0/s1 |
| InChIKey | OOKQZFGDGVBFHT-GPANFISMSA-N |
| XLogP | 3.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |