C30H38FNO2 — CID 89275431
[(1S)-3-ethenyl-2-[2-[(4-fluorophenyl)methylamino]ethyl]-1-methylcyclobutyl] 1-phenylcycloheptane-1-carboxylate (PubChem CID 89275431) has the molecular formula C30H38FNO2 and a molecular weight of 463.64 g/mol. Its IUPAC name is [(1S)-3-ethenyl-2-[2-[(4-fluorophenyl)methylamino]ethyl]-1-methylcyclobutyl] 1-phenylcycloheptane-1-carboxylate.
| Compound Name | [(1S)-3-ethenyl-2-[2-[(4-fluorophenyl)methylamino]ethyl]-1-methylcyclobutyl] 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 89275431 |
| Molecular Formula | C30H38FNO2 |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | [(1S)-3-ethenyl-2-[2-[(4-fluorophenyl)methylamino]ethyl]-1-methylcyclobutyl] 1-phenylcycloheptane-1-carboxylate |
| SMILES | C=CC1C[C@](C)(OC(=O)C2(c3ccccc3)CCCCCC2)C1CCNCc1ccc(F)cc1 |
| InChI | InChI=1S/C30H38FNO2/c1-3-24-21-29(2,27(24)17-20-32-22-23-13-15-26(31)16-14-23)34-28(33)30(18-9-4-5-10-19-30)25-11-7-6-8-12-25/h3,6-8,11-16,24,27,32H,1,4-5,9-10,17-22H2,2H3/t24?,27?,29-/m0/s1 |
| InChIKey | FHSFWBQZSJNDPZ-ZAYHJENTSA-N |
| XLogP | 6.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|