C25H23FN8O2 — CID 143894624
5-N-[[4-(N'-diazenylcarbamimidoyl)phenyl]methyl]-2-N-[(4-fluoro-3-methylphenyl)methyl]imidazo[1,2-a]pyridine-2,5-dicarboxamide (PubChem CID 143894624) has the molecular formula C25H23FN8O2 and a molecular weight of 486.51 g/mol. Its IUPAC name is 5-N-[[4-(N'-diazenylcarbamimidoyl)phenyl]methyl]-2-N-[(4-fluoro-3-methylphenyl)methyl]imidazo[1,2-a]pyridine-2,5-dicarboxamide.
| Compound Name | 5-N-[[4-(N'-diazenylcarbamimidoyl)phenyl]methyl]-2-N-[(4-fluoro-3-methylphenyl)methyl]imidazo[1,2-a]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 143894624 |
| Molecular Formula | C25H23FN8O2 |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 5-N-[[4-(N'-diazenylcarbamimidoyl)phenyl]methyl]-2-N-[(4-fluoro-3-methylphenyl)methyl]imidazo[1,2-a]pyridine-2,5-dicarboxamide |
| SMILES | [H]/N=N/N=C(N)c1ccc(CNC(=O)c2cccc3nc(C(=O)NCc4ccc(F)c(C)c4)cn23)cc1 |
| InChI | InChI=1S/C25H23FN8O2/c1-15-11-17(7-10-19(15)26)13-29-24(35)20-14-34-21(3-2-4-22(34)31-20)25(36)30-12-16-5-8-18(9-6-16)23(27)32-33-28/h2-11,14H,12-13H2,1H3,(H,29,35)(H,30,36)(H3,27,28,32) |
| InChIKey | MGKWULWZYXGHNV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 150.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|