C15H13N5O2 — CID 140605964
2-N-(pyridin-3-ylmethyl)imidazo[1,2-a]pyridine-2,5-dicarboxamide (PubChem CID 140605964) has the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-N-(pyridin-3-ylmethyl)imidazo[1,2-a]pyridine-2,5-dicarboxamide.
| Compound Name | 2-N-(pyridin-3-ylmethyl)imidazo[1,2-a]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 140605964 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-N-(pyridin-3-ylmethyl)imidazo[1,2-a]pyridine-2,5-dicarboxamide |
| SMILES | NC(=O)c1cccc2nc(C(=O)NCc3cccnc3)cn12 |
| InChI | InChI=1S/C15H13N5O2/c16-14(21)12-4-1-5-13-19-11(9-20(12)13)15(22)18-8-10-3-2-6-17-7-10/h1-7,9H,8H2,(H2,16,21)(H,18,22) |
| InChIKey | WNXNOHRHVPBKSY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |