C24H22FN5O2 — CID 70245525
5-N-[(3-aminophenyl)methyl]-2-N-[(4-fluoro-3-methylphenyl)methyl]imidazo[1,2-a]pyridine-2,5-dicarboxamide (PubChem CID 70245525) has the molecular formula C24H22FN5O2 and a molecular weight of 431.47 g/mol. Its IUPAC name is 5-N-[(3-aminophenyl)methyl]-2-N-[(4-fluoro-3-methylphenyl)methyl]imidazo[1,2-a]pyridine-2,5-dicarboxamide.
| Compound Name | 5-N-[(3-aminophenyl)methyl]-2-N-[(4-fluoro-3-methylphenyl)methyl]imidazo[1,2-a]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 70245525 |
| Molecular Formula | C24H22FN5O2 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 5-N-[(3-aminophenyl)methyl]-2-N-[(4-fluoro-3-methylphenyl)methyl]imidazo[1,2-a]pyridine-2,5-dicarboxamide |
| SMILES | Cc1cc(CNC(=O)c2cn3c(C(=O)NCc4cccc(N)c4)cccc3n2)ccc1F |
| InChI | InChI=1S/C24H22FN5O2/c1-15-10-17(8-9-19(15)25)13-27-23(31)20-14-30-21(6-3-7-22(30)29-20)24(32)28-12-16-4-2-5-18(26)11-16/h2-11,14H,12-13,26H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | YIIIEHYTDJCDMU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|