C18H28FN3O — CID 143895451
N-[(2E,5Z)-5-(3-aminopyrrolidin-1-yl)-6-fluoro-4-propan-2-ylideneocta-2,5,7-trien-3-yl]propanamide (PubChem CID 143895451) has the molecular formula C18H28FN3O and a molecular weight of 321.44 g/mol. Its IUPAC name is N-[(2E,5Z)-5-(3-aminopyrrolidin-1-yl)-6-fluoro-4-propan-2-ylideneocta-2,5,7-trien-3-yl]propanamide.
| Compound Name | N-[(2E,5Z)-5-(3-aminopyrrolidin-1-yl)-6-fluoro-4-propan-2-ylideneocta-2,5,7-trien-3-yl]propanamide |
|---|---|
| PubChem CID | 143895451 |
| Molecular Formula | C18H28FN3O |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | N-[(2E,5Z)-5-(3-aminopyrrolidin-1-yl)-6-fluoro-4-propan-2-ylideneocta-2,5,7-trien-3-yl]propanamide |
| SMILES | C=C/C(F)=C(\C(=C(C)C)/C(=C\C)NC(=O)CC)N1CCC(N)C1 |
| InChI | InChI=1S/C18H28FN3O/c1-6-14(19)18(22-10-9-13(20)11-22)17(12(4)5)15(7-2)21-16(23)8-3/h6-7,13H,1,8-11,20H2,2-5H3,(H,21,23)/b15-7+,18-14- |
| InChIKey | ALJQUQZTNJRELM-QFFGNWAYSA-N |
| XLogP | 3.15 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|