C32H34F2N4O6 — CID 143897117
3-[4-[(1R,2S)-1-(4H-1,3-benzodioxin-7-yl)-2-(2,2-difluoropropanoylamino)propoxy]-2-methanimidoylanilino]-N-(oxolan-3-yl)benzamide (PubChem CID 143897117) has the molecular formula C32H34F2N4O6 and a molecular weight of 608.64 g/mol. Its IUPAC name is 3-[4-[(1R,2S)-1-(4H-1,3-benzodioxin-7-yl)-2-(2,2-difluoropropanoylamino)propoxy]-2-methanimidoylanilino]-N-(oxolan-3-yl)benzamide.
| Compound Name | 3-[4-[(1R,2S)-1-(4H-1,3-benzodioxin-7-yl)-2-(2,2-difluoropropanoylamino)propoxy]-2-methanimidoylanilino]-N-(oxolan-3-yl)benzamide |
|---|---|
| PubChem CID | 143897117 |
| Molecular Formula | C32H34F2N4O6 |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 3-[4-[(1R,2S)-1-(4H-1,3-benzodioxin-7-yl)-2-(2,2-difluoropropanoylamino)propoxy]-2-methanimidoylanilino]-N-(oxolan-3-yl)benzamide |
| SMILES | [H]/N=C/c1cc(O[C@H](c2ccc3c(c2)OCOC3)[C@H](C)NC(=O)C(C)(F)F)ccc1Nc1cccc(C(=O)NC2CCOC2)c1 |
| InChI | InChI=1S/C32H34F2N4O6/c1-19(36-31(40)32(2,33)34)29(20-6-7-22-16-42-18-43-28(22)14-20)44-26-8-9-27(23(13-26)15-35)37-24-5-3-4-21(12-24)30(39)38-25-10-11-41-17-25/h3-9,12-15,19,25,29,35,37H,10-11,16-18H2,1-2H3,(H,36,40)(H,38,39)/b35-15+/t19-,25?,29-/m0/s1 |
| InChIKey | GNWVFWDWCRSIEE-CJBZKRTPSA-N |
| XLogP | 5.09 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|