C24H20F6N3O2+ — CID 143701105
[4-[(1R,2S)-1-(3,4-difluorophenyl)-2-[(2,2,2-trifluoroacetyl)amino]propoxy]-2-methanimidoylphenyl]-(4-fluorophenyl)azanium (PubChem CID 143701105) has the molecular formula C24H20F6N3O2+ and a molecular weight of 496.43 g/mol. Its IUPAC name is [4-[(1R,2S)-1-(3,4-difluorophenyl)-2-[(2,2,2-trifluoroacetyl)amino]propoxy]-2-methanimidoylphenyl]-(4-fluorophenyl)azanium.
| Compound Name | [4-[(1R,2S)-1-(3,4-difluorophenyl)-2-[(2,2,2-trifluoroacetyl)amino]propoxy]-2-methanimidoylphenyl]-(4-fluorophenyl)azanium |
|---|---|
| PubChem CID | 143701105 |
| Molecular Formula | C24H20F6N3O2+ |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | [4-[(1R,2S)-1-(3,4-difluorophenyl)-2-[(2,2,2-trifluoroacetyl)amino]propoxy]-2-methanimidoylphenyl]-(4-fluorophenyl)azanium |
| SMILES | [H]/N=C/c1cc(O[C@H](c2ccc(F)c(F)c2)[C@H](C)NC(=O)C(F)(F)F)ccc1[NH2+]c1ccc(F)cc1 |
| InChI | InChI=1S/C24H19F6N3O2/c1-13(32-23(34)24(28,29)30)22(14-2-8-19(26)20(27)11-14)35-18-7-9-21(15(10-18)12-31)33-17-5-3-16(25)4-6-17/h2-13,22,31,33H,1H3,(H,32,34)/p+1/b31-12+/t13-,22-/m0/s1 |
| InChIKey | GFLPMPSIIJMXNU-MWEGKVRSSA-O |
| XLogP | 4.82 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|