C27H27FN4O2S — CID 143677606
4-[(1R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfanylamino]-1-phenylpropoxy]-N-(4-fluorophenyl)-2-methanimidoylaniline (PubChem CID 143677606) has the molecular formula C27H27FN4O2S and a molecular weight of 490.60 g/mol. Its IUPAC name is 4-[(1R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfanylamino]-1-phenylpropoxy]-N-(4-fluorophenyl)-2-methanimidoylaniline.
| Compound Name | 4-[(1R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfanylamino]-1-phenylpropoxy]-N-(4-fluorophenyl)-2-methanimidoylaniline |
|---|---|
| PubChem CID | 143677606 |
| Molecular Formula | C27H27FN4O2S |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 4-[(1R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfanylamino]-1-phenylpropoxy]-N-(4-fluorophenyl)-2-methanimidoylaniline |
| SMILES | [H]/N=C/c1cc(O[C@H](c2ccccc2)C(C)NSc2c(C)noc2C)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C27H27FN4O2S/c1-17(32-35-27-18(2)31-34-19(27)3)26(20-7-5-4-6-8-20)33-24-13-14-25(21(15-24)16-29)30-23-11-9-22(28)10-12-23/h4-17,26,29-30,32H,1-3H3/b29-16+/t17?,26-/m0/s1 |
| InChIKey | NBYPSLCVQSSZRP-QMPGVTPSSA-N |
| XLogP | 6.98 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|