C27H28FN3O4 — CID 143700948
methyl 2-[[(1R)-1-[4-[[(3Z,5E)-5-fluoroocta-1,3,5,7-tetraen-2-yl]amino]-3-methanimidoylphenoxy]-1-phenylpropan-2-yl]amino]-2-oxoacetate (PubChem CID 143700948) has the molecular formula C27H28FN3O4 and a molecular weight of 477.54 g/mol. Its IUPAC name is methyl 2-[[(1R)-1-[4-[[(3Z,5E)-5-fluoroocta-1,3,5,7-tetraen-2-yl]amino]-3-methanimidoylphenoxy]-1-phenylpropan-2-yl]amino]-2-oxoacetate.
| Compound Name | methyl 2-[[(1R)-1-[4-[[(3Z,5E)-5-fluoroocta-1,3,5,7-tetraen-2-yl]amino]-3-methanimidoylphenoxy]-1-phenylpropan-2-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 143700948 |
| Molecular Formula | C27H28FN3O4 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | methyl 2-[[(1R)-1-[4-[[(3Z,5E)-5-fluoroocta-1,3,5,7-tetraen-2-yl]amino]-3-methanimidoylphenoxy]-1-phenylpropan-2-yl]amino]-2-oxoacetate |
| SMILES | [H]/N=C/c1cc(O[C@H](c2ccccc2)C(C)NC(=O)C(=O)OC)ccc1NC(=C)/C=C\C(F)=C/C=C |
| InChI | InChI=1S/C27H28FN3O4/c1-5-9-22(28)13-12-18(2)30-24-15-14-23(16-21(24)17-29)35-25(20-10-7-6-8-11-20)19(3)31-26(32)27(33)34-4/h5-17,19,25,29-30H,1-2H2,3-4H3,(H,31,32)/b13-12-,22-9+,29-17+/t19?,25-/m0/s1 |
| InChIKey | SYXKNKQITVSTMC-OYHDMZNKSA-N |
| XLogP | 5.00 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|