C27H32N2O5 — CID 175100564
bis[2-(2-methylprop-2-enoylamino)-1-phenylpropyl] carbonate (PubChem CID 175100564) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is bis[2-(2-methylprop-2-enoylamino)-1-phenylpropyl] carbonate.
| Compound Name | bis[2-(2-methylprop-2-enoylamino)-1-phenylpropyl] carbonate |
|---|---|
| PubChem CID | 175100564 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | bis[2-(2-methylprop-2-enoylamino)-1-phenylpropyl] carbonate |
| SMILES | C=C(C)C(=O)NC(C)C(OC(=O)OC(c1ccccc1)C(C)NC(=O)C(=C)C)c1ccccc1 |
| InChI | InChI=1S/C27H32N2O5/c1-17(2)25(30)28-19(5)23(21-13-9-7-10-14-21)33-27(32)34-24(22-15-11-8-12-16-22)20(6)29-26(31)18(3)4/h7-16,19-20,23-24H,1,3H2,2,4-6H3,(H,28,30)(H,29,31) |
| InChIKey | IQAJMKAFFVPTFE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|