C26H27FN4O4 — CID 143701069
N'-[(1R,2S)-1-[4-(4-fluoroanilino)-3-methanimidoylphenoxy]-1-(3-methoxyphenyl)propan-2-yl]-N-methyloxamide (PubChem CID 143701069) has the molecular formula C26H27FN4O4 and a molecular weight of 478.52 g/mol. Its IUPAC name is N'-[(1R,2S)-1-[4-(4-fluoroanilino)-3-methanimidoylphenoxy]-1-(3-methoxyphenyl)propan-2-yl]-N-methyloxamide.
| Compound Name | N'-[(1R,2S)-1-[4-(4-fluoroanilino)-3-methanimidoylphenoxy]-1-(3-methoxyphenyl)propan-2-yl]-N-methyloxamide |
|---|---|
| PubChem CID | 143701069 |
| Molecular Formula | C26H27FN4O4 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | N'-[(1R,2S)-1-[4-(4-fluoroanilino)-3-methanimidoylphenoxy]-1-(3-methoxyphenyl)propan-2-yl]-N-methyloxamide |
| SMILES | [H]/N=C/c1cc(O[C@H](c2cccc(OC)c2)[C@H](C)NC(=O)C(=O)NC)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H27FN4O4/c1-16(30-26(33)25(32)29-2)24(17-5-4-6-21(13-17)34-3)35-22-11-12-23(18(14-22)15-28)31-20-9-7-19(27)8-10-20/h4-16,24,28,31H,1-3H3,(H,29,32)(H,30,33)/b28-15+/t16-,24-/m0/s1 |
| InChIKey | HQYIGFXDUQHUIX-VVSOVGEDSA-N |
| XLogP | 3.95 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|