C6H10N2O — CID 143897171
(Z)-4-imino-N,3-dimethylbut-2-enamide (PubChem CID 143897171) has the molecular formula C6H10N2O and a molecular weight of 126.16 g/mol. Its IUPAC name is (Z)-4-imino-N,3-dimethylbut-2-enamide.
| Compound Name | (Z)-4-imino-N,3-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 143897171 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | (Z)-4-imino-N,3-dimethylbut-2-enamide |
| SMILES | [H]/N=C/C(C)=C\C(=O)NC |
| InChI | InChI=1S/C6H10N2O/c1-5(4-7)3-6(9)8-2/h3-4,7H,1-2H3,(H,8,9)/b5-3-,7-4+ |
| InChIKey | NGYSTBPJIBJQBT-XKSOLRDRSA-N |
| XLogP | 0.33 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|