C15H26FN3O2 — CID 143897546
ethane;(2S)-1-[2-(4-fluoroanilino)acetyl]pyrrolidine-2-carboxamide;molecular hydrogen (PubChem CID 143897546) has the molecular formula C15H26FN3O2 and a molecular weight of 299.39 g/mol. Its IUPAC name is ethane;(2S)-1-[2-(4-fluoroanilino)acetyl]pyrrolidine-2-carboxamide;molecular hydrogen.
| Compound Name | ethane;(2S)-1-[2-(4-fluoroanilino)acetyl]pyrrolidine-2-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 143897546 |
| Molecular Formula | C15H26FN3O2 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | ethane;(2S)-1-[2-(4-fluoroanilino)acetyl]pyrrolidine-2-carboxamide;molecular hydrogen |
| SMILES | CC.NC(=O)[C@@H]1CCCN1C(=O)CNc1ccc(F)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C13H16FN3O2.C2H6.2H2/c14-9-3-5-10(6-4-9)16-8-12(18)17-7-1-2-11(17)13(15)19;1-2;;/h3-6,11,16H,1-2,7-8H2,(H2,15,19);1-2H3;2*1H/t11-;;;/m0.../s1 |
| InChIKey | CMQJCPYVUDKEFW-XVSRHIFFSA-N |
| XLogP | 2.23 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |