C25H38FN3O3S — CID 143899383
tert-butyl (2R)-2-(4-cyclobutyl-1,4-diazepane-1-carbonyl)pyrrolidine-1-carboxylate;4-fluorobenzenethiol (PubChem CID 143899383) has the molecular formula C25H38FN3O3S and a molecular weight of 479.66 g/mol. Its IUPAC name is tert-butyl (2R)-2-(4-cyclobutyl-1,4-diazepane-1-carbonyl)pyrrolidine-1-carboxylate;4-fluorobenzenethiol.
| Compound Name | tert-butyl (2R)-2-(4-cyclobutyl-1,4-diazepane-1-carbonyl)pyrrolidine-1-carboxylate;4-fluorobenzenethiol |
|---|---|
| PubChem CID | 143899383 |
| Molecular Formula | C25H38FN3O3S |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | tert-butyl (2R)-2-(4-cyclobutyl-1,4-diazepane-1-carbonyl)pyrrolidine-1-carboxylate;4-fluorobenzenethiol |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1C(=O)N1CCCN(C2CCC2)CC1.Fc1ccc(S)cc1 |
| InChI | InChI=1S/C19H33N3O3.C6H5FS/c1-19(2,3)25-18(24)22-12-5-9-16(22)17(23)21-11-6-10-20(13-14-21)15-7-4-8-15;7-5-1-3-6(8)4-2-5/h15-16H,4-14H2,1-3H3;1-4,8H/t16-;/m1./s1 |
| InChIKey | WYMZEBZHBJTYDJ-PKLMIRHRSA-N |
| XLogP | 4.59 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|