About (4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane
(4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane (PubChem CID 143901623) has the molecular formula C18H29NS
and a molecular weight of 291.50 g/mol. Its IUPAC name is (4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane.
Molecular Properties
| Compound Name | (4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane |
| PubChem CID | 143901623 |
| Molecular Formula | C18H29NS |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane |
| SMILES | Cc1cccc2c1ccn2S(C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H29NS/c1-13(2)20(14(3)4,15(5)6)19-12-11-17-16(7)9-8-10-18(17)19/h8-15H,1-7H3 |
| InChIKey | VIRGYZISEGRXKN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane?
The IUPAC name of (4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane (CID 143901623) is (4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane.
What is the SMILES notation for (4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane?
The canonical SMILES for (4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane is Cc1cccc2c1ccn2S(C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane?
The InChIKey is VIRGYZISEGRXKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NS/c1-13(2)20(14(3)4,15(5)6)19-12-11-17-16(7)9-8-10-18(17)19/h8-15H,1-7H3.
What are the key properties of (4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane?
(4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane has a molecular weight of 291.50 g/mol, XLogP of 5.74, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylindol-1-yl)-tri(propan-2-yl)-λ4-sulfane is sourced from PubChem (CID 143901623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).