C24H33N3 — CID 143901717
[1-cyclopropylidene-2-[4-[(3Z,5E)-3-ethenyl-6-pyrrolidin-1-ylhepta-3,5-dienyl]phenyl]ethyl]hydrazine (PubChem CID 143901717) has the molecular formula C24H33N3 and a molecular weight of 363.55 g/mol. Its IUPAC name is [1-cyclopropylidene-2-[4-[(3Z,5E)-3-ethenyl-6-pyrrolidin-1-ylhepta-3,5-dienyl]phenyl]ethyl]hydrazine.
| Compound Name | [1-cyclopropylidene-2-[4-[(3Z,5E)-3-ethenyl-6-pyrrolidin-1-ylhepta-3,5-dienyl]phenyl]ethyl]hydrazine |
|---|---|
| PubChem CID | 143901717 |
| Molecular Formula | C24H33N3 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.27 |
| IUPAC Name | [1-cyclopropylidene-2-[4-[(3Z,5E)-3-ethenyl-6-pyrrolidin-1-ylhepta-3,5-dienyl]phenyl]ethyl]hydrazine |
| SMILES | C=C/C(=C\C=C(/C)N1CCCC1)CCc1ccc(CC(NN)=C2CC2)cc1 |
| InChI | InChI=1S/C24H33N3/c1-3-20(7-6-19(2)27-16-4-5-17-27)8-9-21-10-12-22(13-11-21)18-24(26-25)23-14-15-23/h3,6-7,10-13,26H,1,4-5,8-9,14-18,25H2,2H3/b19-6+,20-7+ |
| InChIKey | BIRSIGQNCWPZSI-UPICDLATSA-N |
| XLogP | 4.78 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|