C29H38O7 — CID 143904314
(2R,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-5-methyl-3,4-dihydro-2H-chromen-3-ol;(E)-5-methoxy-3-methyl-4-methylidenehept-5-en-2-one (PubChem CID 143904314) has the molecular formula C29H38O7 and a molecular weight of 498.62 g/mol. Its IUPAC name is (2R,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-5-methyl-3,4-dihydro-2H-chromen-3-ol;(E)-5-methoxy-3-methyl-4-methylidenehept-5-en-2-one.
| Compound Name | (2R,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-5-methyl-3,4-dihydro-2H-chromen-3-ol;(E)-5-methoxy-3-methyl-4-methylidenehept-5-en-2-one |
|---|---|
| PubChem CID | 143904314 |
| Molecular Formula | C29H38O7 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | (2R,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-5-methyl-3,4-dihydro-2H-chromen-3-ol;(E)-5-methoxy-3-methyl-4-methylidenehept-5-en-2-one |
| SMILES | C=C(/C(=C\C)OC)C(C)C(C)=O.COc1cc(C)c2c(c1)O[C@H](c1ccc(OC)c(OC)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C19H22O5.C10H16O2/c1-11-7-13(21-2)9-17-14(11)10-15(20)19(24-17)12-5-6-16(22-3)18(8-12)23-4;1-6-10(12-5)8(3)7(2)9(4)11/h5-9,15,19-20H,10H2,1-4H3;6-7H,3H2,1-2,4-5H3/b;10-6+/t15-,19+;/m0./s1 |
| InChIKey | AZMCLDSELOSGFN-CIWQODPESA-N |
| XLogP | 5.38 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|