C14H23N — CID 143906186
ethane;N-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]ethanimine (PubChem CID 143906186) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is ethane;N-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]ethanimine.
| Compound Name | ethane;N-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]ethanimine |
|---|---|
| PubChem CID | 143906186 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | ethane;N-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]ethanimine |
| SMILES | C=c1cccc/c1=C/N=C/C.CC.CC |
| InChI | InChI=1S/C10H11N.2C2H6/c1-3-11-8-10-7-5-4-6-9(10)2;2*1-2/h3-8H,2H2,1H3;2*1-2H3/b10-8-,11-3+;; |
| InChIKey | AIAQQNFXGZNGEB-UVCWJXOASA-N |
| XLogP | 2.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|