C8H7I — CID 159580103
5-(iodomethylidene)-6-methylidenecyclohexa-1,3-diene (PubChem CID 159580103) has the molecular formula C8H7I and a molecular weight of 230.05 g/mol. Its IUPAC name is 5-(iodomethylidene)-6-methylidenecyclohexa-1,3-diene.
| Compound Name | 5-(iodomethylidene)-6-methylidenecyclohexa-1,3-diene |
|---|---|
| PubChem CID | 159580103 |
| Molecular Formula | C8H7I |
| Molecular Weight | 230.05 g/mol |
| Exact Mass | 229.96 |
| IUPAC Name | 5-(iodomethylidene)-6-methylidenecyclohexa-1,3-diene |
| SMILES | C=c1ccccc1=CI |
| InChI | InChI=1S/C8H7I/c1-7-4-2-3-5-8(7)6-9/h2-6H,1H2 |
| InChIKey | FKMUZCIQRXZHPO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.05 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|