C17H24FN5 — CID 143906351
N'-[amino-[3-(dimethylamino)-1-(6-fluoronaphthalen-2-yl)propyl]amino]ethanimidamide (PubChem CID 143906351) has the molecular formula C17H24FN5 and a molecular weight of 317.41 g/mol. Its IUPAC name is N'-[amino-[3-(dimethylamino)-1-(6-fluoronaphthalen-2-yl)propyl]amino]ethanimidamide.
| Compound Name | N'-[amino-[3-(dimethylamino)-1-(6-fluoronaphthalen-2-yl)propyl]amino]ethanimidamide |
|---|---|
| PubChem CID | 143906351 |
| Molecular Formula | C17H24FN5 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | N'-[amino-[3-(dimethylamino)-1-(6-fluoronaphthalen-2-yl)propyl]amino]ethanimidamide |
| SMILES | C/C(N)=N/N(N)C(CCN(C)C)c1ccc2cc(F)ccc2c1 |
| InChI | InChI=1S/C17H24FN5/c1-12(19)21-23(20)17(8-9-22(2)3)15-5-4-14-11-16(18)7-6-13(14)10-15/h4-7,10-11,17H,8-9,20H2,1-3H3,(H2,19,21) |
| InChIKey | YVMGDXKLASIRHX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|