C11H19ClN6 — CID 143906243
N'-[amino-[1-(6-chloro-3-pyridinyl)-3-(dimethylamino)propyl]amino]methanimidamide (PubChem CID 143906243) has the molecular formula C11H19ClN6 and a molecular weight of 270.77 g/mol. Its IUPAC name is N'-[amino-[1-(6-chloro-3-pyridinyl)-3-(dimethylamino)propyl]amino]methanimidamide.
| Compound Name | N'-[amino-[1-(6-chloro-3-pyridinyl)-3-(dimethylamino)propyl]amino]methanimidamide |
|---|---|
| PubChem CID | 143906243 |
| Molecular Formula | C11H19ClN6 |
| Molecular Weight | 270.77 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N'-[amino-[1-(6-chloro-3-pyridinyl)-3-(dimethylamino)propyl]amino]methanimidamide |
| SMILES | CN(C)CCC(c1ccc(Cl)nc1)N(N)/N=C\N |
| InChI | InChI=1S/C11H19ClN6/c1-17(2)6-5-10(18(14)16-8-13)9-3-4-11(12)15-7-9/h3-4,7-8,10H,5-6,14H2,1-2H3,(H2,13,16) |
| InChIKey | SXSYKULUKRSMIY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.77 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|