C11H18ClN5 — CID 143906353
N'-[amino-[1-(4-chlorophenyl)-3-(methylamino)propyl]amino]methanimidamide (PubChem CID 143906353) has the molecular formula C11H18ClN5 and a molecular weight of 255.75 g/mol. Its IUPAC name is N'-[amino-[1-(4-chlorophenyl)-3-(methylamino)propyl]amino]methanimidamide.
| Compound Name | N'-[amino-[1-(4-chlorophenyl)-3-(methylamino)propyl]amino]methanimidamide |
|---|---|
| PubChem CID | 143906353 |
| Molecular Formula | C11H18ClN5 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N'-[amino-[1-(4-chlorophenyl)-3-(methylamino)propyl]amino]methanimidamide |
| SMILES | CNCCC(c1ccc(Cl)cc1)N(N)/N=C\N |
| InChI | InChI=1S/C11H18ClN5/c1-15-7-6-11(17(14)16-8-13)9-2-4-10(12)5-3-9/h2-5,8,11,15H,6-7,14H2,1H3,(H2,13,16) |
| InChIKey | UYNQMZWSMJQFJN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|