C12H20ClN5 — CID 143906363
N'-[amino-[1-(3-chlorophenyl)-3-(dimethylamino)propyl]amino]methanimidamide (PubChem CID 143906363) has the molecular formula C12H20ClN5 and a molecular weight of 269.78 g/mol. Its IUPAC name is N'-[amino-[1-(3-chlorophenyl)-3-(dimethylamino)propyl]amino]methanimidamide.
| Compound Name | N'-[amino-[1-(3-chlorophenyl)-3-(dimethylamino)propyl]amino]methanimidamide |
|---|---|
| PubChem CID | 143906363 |
| Molecular Formula | C12H20ClN5 |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N'-[amino-[1-(3-chlorophenyl)-3-(dimethylamino)propyl]amino]methanimidamide |
| SMILES | CN(C)CCC(c1cccc(Cl)c1)N(N)/N=C\N |
| InChI | InChI=1S/C12H20ClN5/c1-17(2)7-6-12(18(15)16-9-14)10-4-3-5-11(13)8-10/h3-5,8-9,12H,6-7,15H2,1-2H3,(H2,14,16) |
| InChIKey | LQGLCDQIHRKEBC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|