C27H37N3O6 — CID 143906452
[(1S,18S,19R)-17-methoxy-5,7-dioxa-13-azapentacyclo[11.5.1.02,10.04,8.016,19]nonadeca-2,4(8),9,16-tetraen-18-yl] (2R)-2-(dimethylamino)-2-(dimethylcarbamoyl)pentanoate (PubChem CID 143906452) has the molecular formula C27H37N3O6 and a molecular weight of 499.61 g/mol. Its IUPAC name is [(1S,18S,19R)-17-methoxy-5,7-dioxa-13-azapentacyclo[11.5.1.02,10.04,8.016,19]nonadeca-2,4(8),9,16-tetraen-18-yl] (2R)-2-(dimethylamino)-2-(dimethylcarbamoyl)pentanoate.
| Compound Name | [(1S,18S,19R)-17-methoxy-5,7-dioxa-13-azapentacyclo[11.5.1.02,10.04,8.016,19]nonadeca-2,4(8),9,16-tetraen-18-yl] (2R)-2-(dimethylamino)-2-(dimethylcarbamoyl)pentanoate |
|---|---|
| PubChem CID | 143906452 |
| Molecular Formula | C27H37N3O6 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | [(1S,18S,19R)-17-methoxy-5,7-dioxa-13-azapentacyclo[11.5.1.02,10.04,8.016,19]nonadeca-2,4(8),9,16-tetraen-18-yl] (2R)-2-(dimethylamino)-2-(dimethylcarbamoyl)pentanoate |
| SMILES | CCC[C@](C(=O)O[C@@H]1C(OC)=C2CCN3CCc4cc5c(cc4[C@H]1[C@H]23)OCO5)(C(=O)N(C)C)N(C)C |
| InChI | InChI=1S/C27H37N3O6/c1-7-10-27(29(4)5,25(31)28(2)3)26(32)36-24-21-18-14-20-19(34-15-35-20)13-16(18)8-11-30-12-9-17(22(21)30)23(24)33-6/h13-14,21-22,24H,7-12,15H2,1-6H3/t21-,22-,24-,27+/m0/s1 |
| InChIKey | JJVCLKXWFCSUNS-QIPDWXLVSA-N |
| XLogP | 2.14 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|