C18H23NO4 — CID 166938161
2-methoxy-1-[(5S)-7-propyl-5,6,8,9-tetrahydro-[1,3]dioxolo[4,5-h][3]benzazepin-5-yl]prop-2-en-1-one (PubChem CID 166938161) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-methoxy-1-[(5S)-7-propyl-5,6,8,9-tetrahydro-[1,3]dioxolo[4,5-h][3]benzazepin-5-yl]prop-2-en-1-one.
| Compound Name | 2-methoxy-1-[(5S)-7-propyl-5,6,8,9-tetrahydro-[1,3]dioxolo[4,5-h][3]benzazepin-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166938161 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-methoxy-1-[(5S)-7-propyl-5,6,8,9-tetrahydro-[1,3]dioxolo[4,5-h][3]benzazepin-5-yl]prop-2-en-1-one |
| SMILES | C=C(OC)C(=O)[C@@H]1CN(CCC)CCc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C18H23NO4/c1-4-6-19-7-5-13-8-16-17(23-11-22-16)9-14(13)15(10-19)18(20)12(2)21-3/h8-9,15H,2,4-7,10-11H2,1,3H3/t15-/m1/s1 |
| InChIKey | MTCVDUFPKGFUPO-OAHLLOKOSA-N |
| XLogP | 2.50 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|