C15H24O5 — CID 143907057
3-[7-[ethoxy(methoxy)methyl]-5-methoxycyclohepta-1,6-dien-1-yl]propanoic acid (PubChem CID 143907057) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 3-[7-[ethoxy(methoxy)methyl]-5-methoxycyclohepta-1,6-dien-1-yl]propanoic acid.
| Compound Name | 3-[7-[ethoxy(methoxy)methyl]-5-methoxycyclohepta-1,6-dien-1-yl]propanoic acid |
|---|---|
| PubChem CID | 143907057 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 3-[7-[ethoxy(methoxy)methyl]-5-methoxycyclohepta-1,6-dien-1-yl]propanoic acid |
| SMILES | CCOC(OC)C1=CC(OC)CCC=C1CCC(=O)O |
| InChI | InChI=1S/C15H24O5/c1-4-20-15(19-3)13-10-12(18-2)7-5-6-11(13)8-9-14(16)17/h6,10,12,15H,4-5,7-9H2,1-3H3,(H,16,17) |
| InChIKey | LFKSXQIORPAWJW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|