C13H22O4 — CID 11276554
(2R,3R,4E)-4-ethyl-3-(methoxymethoxy)-2,6-dimethylhepta-4,6-dienoic acid (PubChem CID 11276554) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (2R,3R,4E)-4-ethyl-3-(methoxymethoxy)-2,6-dimethylhepta-4,6-dienoic acid.
| Compound Name | (2R,3R,4E)-4-ethyl-3-(methoxymethoxy)-2,6-dimethylhepta-4,6-dienoic acid |
|---|---|
| PubChem CID | 11276554 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (2R,3R,4E)-4-ethyl-3-(methoxymethoxy)-2,6-dimethylhepta-4,6-dienoic acid |
| SMILES | C=C(C)/C=C(\CC)[C@H](OCOC)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C13H22O4/c1-6-11(7-9(2)3)12(17-8-16-5)10(4)13(14)15/h7,10,12H,2,6,8H2,1,3-5H3,(H,14,15)/b11-7+/t10-,12-/m1/s1 |
| InChIKey | HUFAXBKMJSCBNO-CKRBCLJCSA-N |
| XLogP | 2.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|