3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid

C13H20O5 — CID 156603024

IUPAC3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid
SMILESCOC(=O)C(C)=CC=CCC(C)C(O)CC(=O)O
InChIInChI=1S/C13H20O5/c1-9(11(14)8-12(15)16)6-4-5-7-10(2)13(17)18-3/h4-5,7,9,11,14H,6,8H2,1-3H3,(H,15,16)
InChIKeySJGQDRGIIKTZAH-UHFFFAOYSA-N
MW256.30 g/mol
LogP1.52
Rot. Bonds7

About 3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid

3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid (PubChem CID 156603024) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid.

Molecular Properties

Compound Name3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid
PubChem CID156603024
Molecular FormulaC13H20O5
Molecular Weight256.30 g/mol
Exact Mass256.13
IUPAC Name3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid
SMILESCOC(=O)C(C)=CC=CCC(C)C(O)CC(=O)O
InChIInChI=1S/C13H20O5/c1-9(11(14)8-12(15)16)6-4-5-7-10(2)13(17)18-3/h4-5,7,9,11,14H,6,8H2,1-3H3,(H,15,16)
InChIKeySJGQDRGIIKTZAH-UHFFFAOYSA-N
XLogP1.52
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.30
LogP ≤ 51.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid?
The IUPAC name of 3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid (CID 156603024) is 3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid.
What is the SMILES notation for 3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid?
The canonical SMILES for 3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid is COC(=O)C(C)=CC=CCC(C)C(O)CC(=O)O.
What is the InChIKey of 3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid?
The InChIKey is SJGQDRGIIKTZAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O5/c1-9(11(14)8-12(15)16)6-4-5-7-10(2)13(17)18-3/h4-5,7,9,11,14H,6,8H2,1-3H3,(H,15,16).
What are the key properties of 3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid?
3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid has a molecular weight of 256.30 g/mol, XLogP of 1.52, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid is sourced from PubChem (CID 156603024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).