C13H20O5 — CID 125416509
(3S,4R,6E,8E)-3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid (PubChem CID 125416509) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (3S,4R,6E,8E)-3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid.
| Compound Name | (3S,4R,6E,8E)-3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid |
|---|---|
| PubChem CID | 125416509 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (3S,4R,6E,8E)-3-hydroxy-10-methoxy-4,9-dimethyl-10-oxodeca-6,8-dienoic acid |
| SMILES | COC(=O)/C(C)=C/C=C/C[C@@H](C)[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C13H20O5/c1-9(11(14)8-12(15)16)6-4-5-7-10(2)13(17)18-3/h4-5,7,9,11,14H,6,8H2,1-3H3,(H,15,16)/b5-4+,10-7+/t9-,11+/m1/s1 |
| InChIKey | SJGQDRGIIKTZAH-PULHGADDSA-N |
| XLogP | 1.52 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|