C22H31NO — CID 143907135
(3E,4Z,5S)-4-ethylidene-3-(2-methoxyethylidene)-1-methyl-5-[4-(2-methylphenyl)but-1-en-2-yl]piperidine (PubChem CID 143907135) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is (3E,4Z,5S)-4-ethylidene-3-(2-methoxyethylidene)-1-methyl-5-[4-(2-methylphenyl)but-1-en-2-yl]piperidine.
| Compound Name | (3E,4Z,5S)-4-ethylidene-3-(2-methoxyethylidene)-1-methyl-5-[4-(2-methylphenyl)but-1-en-2-yl]piperidine |
|---|---|
| PubChem CID | 143907135 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | (3E,4Z,5S)-4-ethylidene-3-(2-methoxyethylidene)-1-methyl-5-[4-(2-methylphenyl)but-1-en-2-yl]piperidine |
| SMILES | C=C(CCc1ccccc1C)[C@@H]1CN(C)CC(=C/COC)/C1=C\C |
| InChI | InChI=1S/C22H31NO/c1-6-21-20(13-14-24-5)15-23(4)16-22(21)18(3)11-12-19-10-8-7-9-17(19)2/h6-10,13,22H,3,11-12,14-16H2,1-2,4-5H3/b20-13-,21-6+/t22-/m0/s1 |
| InChIKey | KYTBAJBNOJTOIS-PGHOPIAOSA-N |
| XLogP | 4.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|