C11H15ClN2 — CID 143907992
7-chloro-3-ethylimidazo[1,2-a]pyridine;ethane (PubChem CID 143907992) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is 7-chloro-3-ethylimidazo[1,2-a]pyridine;ethane.
| Compound Name | 7-chloro-3-ethylimidazo[1,2-a]pyridine;ethane |
|---|---|
| PubChem CID | 143907992 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 7-chloro-3-ethylimidazo[1,2-a]pyridine;ethane |
| SMILES | CC.CCc1cnc2cc(Cl)ccn12 |
| InChI | InChI=1S/C9H9ClN2.C2H6/c1-2-8-6-11-9-5-7(10)3-4-12(8)9;1-2/h3-6H,2H2,1H3;1-2H3 |
| InChIKey | ZOBBVMBHVRQEQM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |