C25H30N4O4 — CID 143910080
3,4-diethoxy-N-[3-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-1H-indole-4-carboximidoyl]benzamide (PubChem CID 143910080) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 3,4-diethoxy-N-[3-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-1H-indole-4-carboximidoyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[3-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-1H-indole-4-carboximidoyl]benzamide |
|---|---|
| PubChem CID | 143910080 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 3,4-diethoxy-N-[3-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-1H-indole-4-carboximidoyl]benzamide |
| SMILES | [H]/N=C(\NC(=O)c1ccc(OCC)c(OCC)c1)c1cccc2[nH]cc(CN3CC[C@@H](O)C3)c12 |
| InChI | InChI=1S/C25H30N4O4/c1-3-32-21-9-8-16(12-22(21)33-4-2)25(31)28-24(26)19-6-5-7-20-23(19)17(13-27-20)14-29-11-10-18(30)15-29/h5-9,12-13,18,27,30H,3-4,10-11,14-15H2,1-2H3,(H2,26,28,31)/t18-/m1/s1 |
| InChIKey | ZROVMOHEVRTLLL-GOSISDBHSA-N |
| XLogP | 3.29 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|