C23H17ClN4O2 — CID 143910602
4-[(R)-amino-[4-(6-chloro-2-pyridinyl)-1-methyl-2-oxoquinolin-6-yl]-hydroxymethyl]benzonitrile (PubChem CID 143910602) has the molecular formula C23H17ClN4O2 and a molecular weight of 416.87 g/mol. Its IUPAC name is 4-[(R)-amino-[4-(6-chloro-2-pyridinyl)-1-methyl-2-oxoquinolin-6-yl]-hydroxymethyl]benzonitrile.
| Compound Name | 4-[(R)-amino-[4-(6-chloro-2-pyridinyl)-1-methyl-2-oxoquinolin-6-yl]-hydroxymethyl]benzonitrile |
|---|---|
| PubChem CID | 143910602 |
| Molecular Formula | C23H17ClN4O2 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 4-[(R)-amino-[4-(6-chloro-2-pyridinyl)-1-methyl-2-oxoquinolin-6-yl]-hydroxymethyl]benzonitrile |
| SMILES | Cn1c(=O)cc(-c2cccc(Cl)n2)c2cc([C@](N)(O)c3ccc(C#N)cc3)ccc21 |
| InChI | InChI=1S/C23H17ClN4O2/c1-28-20-10-9-16(23(26,30)15-7-5-14(13-25)6-8-15)11-18(20)17(12-22(28)29)19-3-2-4-21(24)27-19/h2-12,30H,26H2,1H3/t23-/m1/s1 |
| InChIKey | QBUKOXZXTWALAG-HSZRJFAPSA-N |
| XLogP | 3.28 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|