C21H15Cl2N3O2 — CID 143997385
6-[(4-chlorophenyl)-hydroxymethyl]-4-(6-chloro-2-pyridinyl)-1-methyl-1,5-naphthyridin-2-one (PubChem CID 143997385) has the molecular formula C21H15Cl2N3O2 and a molecular weight of 412.28 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)-hydroxymethyl]-4-(6-chloro-2-pyridinyl)-1-methyl-1,5-naphthyridin-2-one.
| Compound Name | 6-[(4-chlorophenyl)-hydroxymethyl]-4-(6-chloro-2-pyridinyl)-1-methyl-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 143997385 |
| Molecular Formula | C21H15Cl2N3O2 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 6-[(4-chlorophenyl)-hydroxymethyl]-4-(6-chloro-2-pyridinyl)-1-methyl-1,5-naphthyridin-2-one |
| SMILES | Cn1c(=O)cc(-c2cccc(Cl)n2)c2nc(C(O)c3ccc(Cl)cc3)ccc21 |
| InChI | InChI=1S/C21H15Cl2N3O2/c1-26-17-10-9-16(21(28)12-5-7-13(22)8-6-12)25-20(17)14(11-19(26)27)15-3-2-4-18(23)24-15/h2-11,21,28H,1H3 |
| InChIKey | MLQGUDRGWKTGSO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|