C23H16ClN3O2 — CID 143997448
6-[(4-chlorophenyl)-hydroxymethyl]-4-(6-ethynyl-2-pyridinyl)-1-methyl-1,8-naphthyridin-2-one (PubChem CID 143997448) has the molecular formula C23H16ClN3O2 and a molecular weight of 401.85 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)-hydroxymethyl]-4-(6-ethynyl-2-pyridinyl)-1-methyl-1,8-naphthyridin-2-one.
| Compound Name | 6-[(4-chlorophenyl)-hydroxymethyl]-4-(6-ethynyl-2-pyridinyl)-1-methyl-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 143997448 |
| Molecular Formula | C23H16ClN3O2 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 6-[(4-chlorophenyl)-hydroxymethyl]-4-(6-ethynyl-2-pyridinyl)-1-methyl-1,8-naphthyridin-2-one |
| SMILES | C#Cc1cccc(-c2cc(=O)n(C)c3ncc(C(O)c4ccc(Cl)cc4)cc23)n1 |
| InChI | InChI=1S/C23H16ClN3O2/c1-3-17-5-4-6-20(26-17)18-12-21(28)27(2)23-19(18)11-15(13-25-23)22(29)14-7-9-16(24)10-8-14/h1,4-13,22,29H,2H3 |
| InChIKey | GGLPVUOGSNBQQY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|