C28H23ClN4O2 — CID 143997300
6-[(4-chlorophenyl)-hydroxymethyl]-4-(3-ethynylphenyl)-1-methyl-1,8-naphthyridin-2-one;1-methylimidazole (PubChem CID 143997300) has the molecular formula C28H23ClN4O2 and a molecular weight of 482.97 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)-hydroxymethyl]-4-(3-ethynylphenyl)-1-methyl-1,8-naphthyridin-2-one;1-methylimidazole.
| Compound Name | 6-[(4-chlorophenyl)-hydroxymethyl]-4-(3-ethynylphenyl)-1-methyl-1,8-naphthyridin-2-one;1-methylimidazole |
|---|---|
| PubChem CID | 143997300 |
| Molecular Formula | C28H23ClN4O2 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 6-[(4-chlorophenyl)-hydroxymethyl]-4-(3-ethynylphenyl)-1-methyl-1,8-naphthyridin-2-one;1-methylimidazole |
| SMILES | C#Cc1cccc(-c2cc(=O)n(C)c3ncc(C(O)c4ccc(Cl)cc4)cc23)c1.Cn1ccnc1 |
| InChI | InChI=1S/C24H17ClN2O2.C4H6N2/c1-3-15-5-4-6-17(11-15)20-13-22(28)27(2)24-21(20)12-18(14-26-24)23(29)16-7-9-19(25)10-8-16;1-6-3-2-5-4-6/h1,4-14,23,29H,2H3;2-4H,1H3 |
| InChIKey | WTKQTYNRGCWKRE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|