C27H23ClN6O — CID 143910621
4-[amino-[4-(6-chloro-2-pyridinyl)-1-methyl-2-oxoquinolin-6-yl]methyl]benzonitrile;1-methylimidazole (PubChem CID 143910621) has the molecular formula C27H23ClN6O and a molecular weight of 482.98 g/mol. Its IUPAC name is 4-[amino-[4-(6-chloro-2-pyridinyl)-1-methyl-2-oxoquinolin-6-yl]methyl]benzonitrile;1-methylimidazole.
| Compound Name | 4-[amino-[4-(6-chloro-2-pyridinyl)-1-methyl-2-oxoquinolin-6-yl]methyl]benzonitrile;1-methylimidazole |
|---|---|
| PubChem CID | 143910621 |
| Molecular Formula | C27H23ClN6O |
| Molecular Weight | 482.98 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 4-[amino-[4-(6-chloro-2-pyridinyl)-1-methyl-2-oxoquinolin-6-yl]methyl]benzonitrile;1-methylimidazole |
| SMILES | Cn1c(=O)cc(-c2cccc(Cl)n2)c2cc(C(N)c3ccc(C#N)cc3)ccc21.Cn1ccnc1 |
| InChI | InChI=1S/C23H17ClN4O.C4H6N2/c1-28-20-10-9-16(23(26)15-7-5-14(13-25)6-8-15)11-18(20)17(12-22(28)29)19-3-2-4-21(24)27-19;1-6-3-2-5-4-6/h2-12,23H,26H2,1H3;2-4H,1H3 |
| InChIKey | CWPVQVHSUNSLTB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.98 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|