C20H24FN3O3 — CID 143913622
N-cyclohexyl-2-hydroxyacetamide;6-(3-fluorophenyl)pyridine-3-carboxamide (PubChem CID 143913622) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is N-cyclohexyl-2-hydroxyacetamide;6-(3-fluorophenyl)pyridine-3-carboxamide.
| Compound Name | N-cyclohexyl-2-hydroxyacetamide;6-(3-fluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 143913622 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-cyclohexyl-2-hydroxyacetamide;6-(3-fluorophenyl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(-c2cccc(F)c2)nc1.O=C(CO)NC1CCCCC1 |
| InChI | InChI=1S/C12H9FN2O.C8H15NO2/c13-10-3-1-2-8(6-10)11-5-4-9(7-15-11)12(14)16;10-6-8(11)9-7-4-2-1-3-5-7/h1-7H,(H2,14,16);7,10H,1-6H2,(H,9,11) |
| InChIKey | HRESONRXUZCAQF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |