C26H24ClFN4O2S — CID 143915399
N-[2-chloro-5-[4-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfinamide (PubChem CID 143915399) has the molecular formula C26H24ClFN4O2S and a molecular weight of 511.02 g/mol. Its IUPAC name is N-[2-chloro-5-[4-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfinamide.
| Compound Name | N-[2-chloro-5-[4-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfinamide |
|---|---|
| PubChem CID | 143915399 |
| Molecular Formula | C26H24ClFN4O2S |
| Molecular Weight | 511.02 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | N-[2-chloro-5-[4-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfinamide |
| SMILES | CC1CN(c2ccnc3ccc(-c4cnc(Cl)c(NS(=O)c5ccc(F)cc5)c4)cc23)CC(C)O1 |
| InChI | InChI=1S/C26H24ClFN4O2S/c1-16-14-32(15-17(2)34-16)25-9-10-29-23-8-3-18(11-22(23)25)19-12-24(26(27)30-13-19)31-35(33)21-6-4-20(28)5-7-21/h3-13,16-17,31H,14-15H2,1-2H3 |
| InChIKey | SHTDTZGWZWMLMD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.02 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|